nayecAshleHbp nayecAshleHbp

04-07-2016
History

contestada

What was the black hand?

Respuesta :

2aquinn 2aquinn

07-03-2020

Answer:

Serbian nationalist/terrorist group responsible for the assassination of Austrian Archduke Franz Ferdinand which resulted in the start of World War I.

Explanation:

Answer Link

Otras preguntas

What do we call the experimental apparatus that William crooks used in his experiments and what did he discover

There is a line that includes the point (-14,-5) and has a slope of 0. What is its equation in slope-intercept form?

cosec(6b+pi/8)=sec(2b-pi/8)

How many liters of a 90% acid solution must be added to 6 liters of a 15% acid solution to obtain a 40% acid solution?

Why does 1o take longer than 2o

Metals lose/gain electrons to form positive _____ Nonmetals lose/gain electrons to form negative ____

Explain more about the periodic table

A skier pushes her ski poles against the ground . Identify the action and reaction forces in this example and explain why the skier moves but earth does not see

When do you show intensity?

a 70 kg runner exerts a force of 35n. what is the acceleration of the runner